C16H25N8O7P — CID 171107856
[(2R,3S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 171107856) has the molecular formula C16H25N8O7P and a molecular weight of 472.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 171107856 |
| Molecular Formula | C16H25N8O7P |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [N-]=[N+]=NCCCCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25N8O7P/c17-23-22-6-4-2-1-3-5-18-14-11-15(20-8-19-14)24(9-21-11)16-13(26)12(25)10(31-16)7-30-32(27,28)29/h8-10,12-13,16,25-26H,1-7H2,(H,18,19,20)(H2,27,28,29)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | ZNJAYGDGZZADSG-XNIJJKJLSA-N |
| XLogP | 0.84 |
| TPSA | 220.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|