C25H43IN7O15P3 — CID 118718977
[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[6-[7-[(2-iodoacetyl)amino]heptanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118718977) has the molecular formula C25H43IN7O15P3 and a molecular weight of 901.48 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[6-[7-[(2-iodoacetyl)amino]heptanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[6-[7-[(2-iodoacetyl)amino]heptanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118718977 |
| Molecular Formula | C25H43IN7O15P3 |
| Molecular Weight | 901.48 g/mol |
| Exact Mass | 901.11 |
| IUPAC Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[6-[7-[(2-iodoacetyl)amino]heptanoylamino]hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C(CI)NCCCCCCC(=O)NCCCCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H43IN7O15P3/c26-13-19(35)28-11-6-2-1-5-9-18(34)27-10-7-3-4-8-12-29-23-20-24(31-15-30-23)33(16-32-20)25-22(37)21(36)17(46-25)14-45-50(41,42)48-51(43,44)47-49(38,39)40/h15-17,21-22,25,36-37H,1-14H2,(H,27,34)(H,28,35)(H,41,42)(H,43,44)(H,29,30,31)(H2,38,39,40)/t17-,21-,22-,25-/m1/s1 |
| InChIKey | ZJDBXFJMAAXARZ-XEWJDLBKSA-N |
| XLogP | 1.38 |
| TPSA | 323.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|