C16H27IN7O14P3 — CID 118718991
[[(2R,3S,4R,5R)-5-[6-amino-8-[4-[(2-iodoacetyl)amino]butylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118718991) has the molecular formula C16H27IN7O14P3 and a molecular weight of 761.25 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-amino-8-[4-[(2-iodoacetyl)amino]butylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-amino-8-[4-[(2-iodoacetyl)amino]butylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118718991 |
| Molecular Formula | C16H27IN7O14P3 |
| Molecular Weight | 761.25 g/mol |
| Exact Mass | 760.99 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-amino-8-[4-[(2-iodoacetyl)amino]butylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1nc(NCCCCNC(=O)CI)n2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H27IN7O14P3/c17-5-9(25)19-3-1-2-4-20-16-23-10-13(18)21-7-22-14(10)24(16)15-12(27)11(26)8(36-15)6-35-40(31,32)38-41(33,34)37-39(28,29)30/h7-8,11-12,15,26-27H,1-6H2,(H,19,25)(H,20,23)(H,31,32)(H,33,34)(H2,18,21,22)(H2,28,29,30)/t8-,11-,12-,15-/m1/s1 |
| InChIKey | RYULCWWGYGDIKM-PMXXHBEXSA-N |
| XLogP | -0.89 |
| TPSA | 320.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|