C14H24N7O7P — CID 78065510
[5-[6-amino-8-(4-aminobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 78065510) has the molecular formula C14H24N7O7P and a molecular weight of 433.36 g/mol. Its IUPAC name is [5-[6-amino-8-(4-aminobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-[6-amino-8-(4-aminobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 78065510 |
| Molecular Formula | C14H24N7O7P |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [5-[6-amino-8-(4-aminobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NCCCCNc1nc2c(N)ncnc2n1C1OC(COP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C14H24N7O7P/c15-3-1-2-4-17-14-20-8-11(16)18-6-19-12(8)21(14)13-10(23)9(22)7(28-13)5-27-29(24,25)26/h6-7,9-10,13,22-23H,1-5,15H2,(H,17,20)(H2,16,18,19)(H2,24,25,26) |
| InChIKey | NGKHZTKYHKECLN-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 224.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|