C18H32N7O14P3 — CID 46876154
[[(2R,3S,4R)-5-[8-(6-acetamidohexylamino)-6-aminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 46876154) has the molecular formula C18H32N7O14P3 and a molecular weight of 663.41 g/mol. Its IUPAC name is [[(2R,3S,4R)-5-[8-(6-acetamidohexylamino)-6-aminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R)-5-[8-(6-acetamidohexylamino)-6-aminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 46876154 |
| Molecular Formula | C18H32N7O14P3 |
| Molecular Weight | 663.41 g/mol |
| Exact Mass | 663.12 |
| IUPAC Name | [[(2R,3S,4R)-5-[8-(6-acetamidohexylamino)-6-aminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(=O)NCCCCCCNc1nc2c(N)ncnc2n1C1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H32N7O14P3/c1-10(26)20-6-4-2-3-5-7-21-18-24-12-15(19)22-9-23-16(12)25(18)17-14(28)13(27)11(37-17)8-36-41(32,33)39-42(34,35)38-40(29,30)31/h9,11,13-14,17,27-28H,2-8H2,1H3,(H,20,26)(H,21,24)(H,32,33)(H,34,35)(H2,19,22,23)(H2,29,30,31)/t11-,13-,14-,17?/m1/s1 |
| InChIKey | GTRXXVPHLGPLMU-IKYDMHQPSA-N |
| XLogP | -0.52 |
| TPSA | 320.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.41 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|