C12H19N5O10P2S — CID 46873840
[(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 46873840) has the molecular formula C12H19N5O10P2S and a molecular weight of 487.32 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 46873840 |
| Molecular Formula | C12H19N5O10P2S |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | [(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CCSc1nc2c(N)ncnc2n1C1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H19N5O10P2S/c1-2-30-12-16-6-9(13)14-4-15-10(6)17(12)11-8(19)7(18)5(26-11)3-25-29(23,24)27-28(20,21)22/h4-5,7-8,11,18-19H,2-3H2,1H3,(H,23,24)(H2,13,14,15)(H2,20,21,22)/t5-,7-,8-,11?/m1/s1 |
| InChIKey | PLJDFHQFIJIWRZ-YNJARDAQSA-N |
| XLogP | -0.63 |
| TPSA | 232.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|