C14H20N5Na2O7PS — CID 46876224
disodium;[(2R,3S,4R)-5-(6-amino-8-butylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 46876224) has the molecular formula C14H20N5Na2O7PS and a molecular weight of 479.36 g/mol. Its IUPAC name is disodium;[(2R,3S,4R)-5-(6-amino-8-butylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[(2R,3S,4R)-5-(6-amino-8-butylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 46876224 |
| Molecular Formula | C14H20N5Na2O7PS |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | disodium;[(2R,3S,4R)-5-(6-amino-8-butylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | CCCCSc1nc2c(N)ncnc2n1C1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C14H22N5O7PS.2Na/c1-2-3-4-28-14-18-8-11(15)16-6-17-12(8)19(14)13-10(21)9(20)7(26-13)5-25-27(22,23)24;;/h6-7,9-10,13,20-21H,2-5H2,1H3,(H2,15,16,17)(H2,22,23,24);;/q;2*+1/p-2/t7-,9-,10-,13?;;/m1../s1 |
| InChIKey | DTIMOFQRKCQKIA-PYKLUYBDSA-L |
| XLogP | -7.23 |
| TPSA | 191.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | -7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|