C12H18N5O7PS — CID 46875021
[(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 46875021) has the molecular formula C12H18N5O7PS and a molecular weight of 407.35 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 46875021 |
| Molecular Formula | C12H18N5O7PS |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [(2R,3S,4R)-5-(6-amino-8-ethylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCSc1nc2c(N)ncnc2n1C1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18N5O7PS/c1-2-26-12-16-6-9(13)14-4-15-10(6)17(12)11-8(19)7(18)5(24-11)3-23-25(20,21)22/h4-5,7-8,11,18-19H,2-3H2,1H3,(H2,13,14,15)(H2,20,21,22)/t5-,7-,8-,11?/m1/s1 |
| InChIKey | LQPLAROCWKAVMM-YNJARDAQSA-N |
| XLogP | -0.75 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|