C16H30N7O7P — CID 50916476
[(2R,3S,4R,5R)-5-(6,8-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N,N-diethylethanamine (PubChem CID 50916476) has the molecular formula C16H30N7O7P and a molecular weight of 463.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6,8-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N,N-diethylethanamine.
| Compound Name | [(2R,3S,4R,5R)-5-(6,8-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 50916476 |
| Molecular Formula | C16H30N7O7P |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6,8-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Nc1ncnc2c1nc(N)n2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N6O7P.C6H15N/c11-7-4-8(14-2-13-7)16(10(12)15-4)9-6(18)5(17)3(23-9)1-22-24(19,20)21;1-4-7(5-2)6-3/h2-3,5-6,9,17-18H,1H2,(H2,12,15)(H2,11,13,14)(H2,19,20,21);4-6H2,1-3H3/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | UVHOXRPTDQLIPY-GWTDSMLYSA-N |
| XLogP | -0.93 |
| TPSA | 215.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|