C16H28N6NaO7P — CID 175677371
sodium;[(2R,3S,4R,5R)-5-[6-(6-aminohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride (PubChem CID 175677371) has the molecular formula C16H28N6NaO7P and a molecular weight of 470.40 g/mol. Its IUPAC name is sodium;[(2R,3S,4R,5R)-5-[6-(6-aminohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride.
| Compound Name | sodium;[(2R,3S,4R,5R)-5-[6-(6-aminohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 175677371 |
| Molecular Formula | C16H28N6NaO7P |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | sodium;[(2R,3S,4R,5R)-5-[6-(6-aminohexylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;hydride |
| SMILES | NCCCCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O.[H-].[Na+] |
| InChI | InChI=1S/C16H27N6O7P.Na.H/c17-5-3-1-2-4-6-18-14-11-15(20-8-19-14)22(9-21-11)16-13(24)12(23)10(29-16)7-28-30(25,26)27;;/h8-10,12-13,16,23-24H,1-7,17H2,(H,18,19,20)(H2,25,26,27);;/q;+1;-1/t10-,12-,13-,16-;;/m1../s1 |
| InChIKey | RCTXVSCXIZTLCD-IPBMGFFTSA-N |
| XLogP | -3.40 |
| TPSA | 198.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|