C14H23N6O5P — CID 101140941
[(2S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 101140941) has the molecular formula C14H23N6O5P and a molecular weight of 386.35 g/mol. Its IUPAC name is [(2S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 101140941 |
| Molecular Formula | C14H23N6O5P |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [(2S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NCCCCNc1ncnc2c1ncn2[C@H]1CC[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C14H23N6O5P/c15-5-1-2-6-16-13-12-14(18-8-17-13)20(9-19-12)11-4-3-10(25-11)7-24-26(21,22)23/h8-11H,1-7,15H2,(H,16,17,18)(H2,21,22,23)/t10-,11+/m0/s1 |
| InChIKey | HZXQLPTWRDWITL-WDEREUQCSA-N |
| XLogP | 0.76 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|