C10H16N5Na2O11P3 — CID 131872177
CID 131872177 (PubChem CID 131872177) has the molecular formula C10H16N5Na2O11P3 and a molecular weight of 521.16 g/mol.
| Compound Name | CID 131872177 |
|---|---|
| PubChem CID | 131872177 |
| Molecular Formula | C10H16N5Na2O11P3 |
| Molecular Weight | 521.16 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1.[Na].[Na] |
| InChI | InChI=1S/C10H16N5O11P3.2Na/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(24-7)3-23-28(19,20)26-29(21,22)25-27(16,17)18;;/h4-7H,1-3H2,(H,19,20)(H,21,22)(H2,11,12,13)(H2,16,17,18);;/t6-,7+;;/m0../s1 |
| InChIKey | LMCLKSVWGFRTRV-AUCRBCQYSA-N |
| XLogP | -0.33 |
| TPSA | 238.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.16 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|