C10H16N5O12P3 — CID 11272129
[[(2R,3S,5R)-5-(6-(15N)azanylpurin-9-yl)-4-deuterio-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 11272129) has the molecular formula C10H16N5O12P3 and a molecular weight of 507.08 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(6-(15N)azanylpurin-9-yl)-4-deuterio-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(6-(15N)azanylpurin-9-yl)-4-deuterio-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11272129 |
| Molecular Formula | C10H16N5O12P3 |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | [[(2R,3S,5R)-5-(6-(15N)azanylpurin-9-yl)-4-deuterio-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [2H][13CH]1[13C@H]([15n]2[13cH][15n][13c]3[13c]([15NH2])[15n][13cH][15n][13c]32)O[13C@H]([13CH2]OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[13C@H]1O |
| InChI | InChI=1S/C10H16N5O12P3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(25-7)2-24-29(20,21)27-30(22,23)26-28(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H,22,23)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1/i1+1D,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1,15+1/t1?,5-,6+,7+ |
| InChIKey | SUYVUBYJARFZHO-QMELFLOLSA-N |
| XLogP | -0.60 |
| TPSA | 258.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|