C16H32N6O21P6 — CID 123973353
[6-aminohexoxy(hydroxy)phosphoryl] [[[[[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 123973353) has the molecular formula C16H32N6O21P6 and a molecular weight of 830.30 g/mol. Its IUPAC name is [6-aminohexoxy(hydroxy)phosphoryl] [[[[[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [6-aminohexoxy(hydroxy)phosphoryl] [[[[[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 123973353 |
| Molecular Formula | C16H32N6O21P6 |
| Molecular Weight | 830.30 g/mol |
| Exact Mass | 830.00 |
| IUPAC Name | [6-aminohexoxy(hydroxy)phosphoryl] [[[[[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | NCCCCCCOP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)CC1O |
| InChI | InChI=1S/C16H32N6O21P6/c17-5-3-1-2-4-6-36-44(24,25)39-46(28,29)41-48(32,33)43-49(34,35)42-47(30,31)40-45(26,27)37-8-12-11(23)7-13(38-12)22-10-21-14-15(18)19-9-20-16(14)22/h9-13,23H,1-8,17H2,(H,24,25)(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35)(H2,18,19,20) |
| InChIKey | RZFAUVORMVCMSA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 413.51 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|