C14H25N6O12P3 — CID 90218311
[[(2R,3S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90218311) has the molecular formula C14H25N6O12P3 and a molecular weight of 562.31 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90218311 |
| Molecular Formula | C14H25N6O12P3 |
| Molecular Weight | 562.31 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | [[(2R,3S,5R)-5-[6-(4-aminobutylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NCCCCNc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C14H25N6O12P3/c15-3-1-2-4-16-13-12-14(18-7-17-13)20(8-19-12)11-5-9(21)10(30-11)6-29-34(25,26)32-35(27,28)31-33(22,23)24/h7-11,21H,1-6,15H2,(H,25,26)(H,27,28)(H,16,17,18)(H2,22,23,24)/t9-,10+,11+/m0/s1 |
| InChIKey | AODPURGYCVONKZ-HBNTYKKESA-N |
| XLogP | -0.03 |
| TPSA | 270.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|