C16H27N8O12P3 — CID 122519722
[[(2S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122519722) has the molecular formula C16H27N8O12P3 and a molecular weight of 616.36 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122519722 |
| Molecular Formula | C16H27N8O12P3 |
| Molecular Weight | 616.36 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | [[(2S,4R,5R)-5-[6-(6-azidohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NCCCCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]1O |
| InChI | InChI=1S/C16H27N8O12P3/c17-23-22-6-4-2-1-3-5-18-14-13-15(20-9-19-14)24(10-21-13)16-12(25)7-11(34-16)8-33-38(29,30)36-39(31,32)35-37(26,27)28/h9-12,16,25H,1-8H2,(H,29,30)(H,31,32)(H,18,19,20)(H2,26,27,28)/t11-,12+,16+/m0/s1 |
| InChIKey | OJWNKNDEZDLFRR-HWWQOWPSSA-N |
| XLogP | 2.10 |
| TPSA | 293.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|