C16H27N8O13P3 — CID 72735280
[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(6-azidohexoxy)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 72735280) has the molecular formula C16H27N8O13P3 and a molecular weight of 632.36 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(6-azidohexoxy)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(6-azidohexoxy)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 72735280 |
| Molecular Formula | C16H27N8O13P3 |
| Molecular Weight | 632.36 g/mol |
| Exact Mass | 632.09 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(6-azidohexoxy)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NCCCCCCO[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H27N8O13P3/c17-14-11-15(20-8-19-14)24(9-21-11)16-13(33-6-4-2-1-3-5-22-23-18)12(25)10(35-16)7-34-39(29,30)37-40(31,32)36-38(26,27)28/h8-10,12-13,16,25H,1-7H2,(H,29,30)(H,31,32)(H2,17,19,20)(H2,26,27,28)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | CHNISIAWLIWQDX-XNIJJKJLSA-N |
| XLogP | 1.27 |
| TPSA | 316.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|