C12H19N8O12P3 — CID 158584117
[[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-(2-azidoethyl)phosphinic acid (PubChem CID 158584117) has the molecular formula C12H19N8O12P3 and a molecular weight of 560.25 g/mol. Its IUPAC name is [[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-(2-azidoethyl)phosphinic acid.
| Compound Name | [[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-(2-azidoethyl)phosphinic acid |
|---|---|
| PubChem CID | 158584117 |
| Molecular Formula | C12H19N8O12P3 |
| Molecular Weight | 560.25 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | [[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-(2-azidoethyl)phosphinic acid |
| SMILES | [N-]=[N+]=NCCP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C12H19N8O12P3/c13-10-7-11(16-4-15-10)20(5-17-7)12-9(22)8(21)6(30-12)3-29-34(25,26)32-35(27,28)31-33(23,24)2-1-18-19-14/h4-6,8-9,12,21-22H,1-3H2,(H,23,24)(H,25,26)(H,27,28)(H2,13,15,16)/t6-,8?,9+,12-/m1/s1 |
| InChIKey | ZRBWEYVZKVBXHK-WURNFRPNSA-N |
| XLogP | -0.23 |
| TPSA | 307.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|