C16H31N7O15P2 — CID 71681298
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate;azane (PubChem CID 71681298) has the molecular formula C16H31N7O15P2 and a molecular weight of 623.41 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate;azane.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate;azane |
|---|---|
| PubChem CID | 71681298 |
| Molecular Formula | C16H31N7O15P2 |
| Molecular Weight | 623.41 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen phosphate;azane |
| SMILES | N.N.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25N5O15P2.2H3N/c17-13-7-14(19-3-18-13)21(4-20-7)15-11(25)9(23)5(34-15)1-32-37(28,29)36-38(30,31)33-2-6-8(22)10(24)12(26)16(27)35-6;;/h3-6,8-12,15-16,22-27H,1-2H2,(H,28,29)(H,30,31)(H2,17,18,19);2*1H3/t5-,6-,8-,9-,10+,11-,12-,15-,16-;;/m1../s1 |
| InChIKey | KNVFDSVNQNDAHZ-DJZWZPHQSA-N |
| XLogP | -3.60 |
| TPSA | 381.75 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.41 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|