C14H24N5O14P3 — CID 176788046
[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(3-methoxypropoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 176788046) has the molecular formula C14H24N5O14P3 and a molecular weight of 579.29 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(3-methoxypropoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(3-methoxypropoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 176788046 |
| Molecular Formula | C14H24N5O14P3 |
| Molecular Weight | 579.29 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(3-methoxypropoxy)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COCCCOC1[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H24N5O14P3/c1-28-3-2-4-29-11-10(20)8(5-30-35(24,25)33-36(26,27)32-34(21,22)23)31-14(11)19-7-18-9-12(15)16-6-17-13(9)19/h6-8,10-11,14,20H,2-5H2,1H3,(H,24,25)(H,26,27)(H2,15,16,17)(H2,21,22,23)/t8-,10+,11?,14-/m1/s1 |
| InChIKey | XIJHOLIUOCKQIY-XNZUMOJTSA-N |
| XLogP | -0.57 |
| TPSA | 277.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|