C13H18N8O4 — CID 24766383
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(3-azidopropoxy)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 24766383) has the molecular formula C13H18N8O4 and a molecular weight of 350.34 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(3-azidopropoxy)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(3-azidopropoxy)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 24766383 |
| Molecular Formula | C13H18N8O4 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(3-azidopropoxy)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=NCCCO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H18N8O4/c14-11-8-12(17-5-16-11)21(6-18-8)13-10(9(23)7(4-22)25-13)24-3-1-2-19-20-15/h5-7,9-10,13,22-23H,1-4H2,(H2,14,16,17)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | BKVWHGLBZZSWME-QYVSTXNMSA-N |
| XLogP | -0.26 |
| TPSA | 177.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|