C10H14N8O9P2 — CID 91515901
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 91515901) has the molecular formula C10H14N8O9P2 and a molecular weight of 452.22 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 91515901 |
| Molecular Formula | C10H14N8O9P2 |
| Molecular Weight | 452.22 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C10H14N8O9P2/c11-8-6-9(14-2-13-8)18(3-15-6)10-5(16-17-12)7(19)4(26-10)1-25-29(23,24)27-28(20,21)22/h2-5,7,10,19H,1H2,(H,23,24)(H2,11,13,14)(H2,20,21,22)/t4-,5-,7-,10-/m1/s1 |
| InChIKey | DJDSAOUWZUSYBN-QYYRPYCUSA-N |
| XLogP | -0.43 |
| TPSA | 261.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|