C10H13N8O6P — CID 171428936
[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 171428936) has the molecular formula C10H13N8O6P and a molecular weight of 372.24 g/mol. Its IUPAC name is [(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 171428936 |
| Molecular Formula | C10H13N8O6P |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [N-]=[N+]=N[C@@H]1C(O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C10H13N8O6P/c11-8-6-9(14-2-13-8)18(3-15-6)10-7(19)5(16-17-12)4(24-10)1-23-25(20,21)22/h2-5,7,10,19H,1H2,(H2,11,13,14)(H2,20,21,22)/t4-,5+,7?,10-/m1/s1 |
| InChIKey | QCWCFKDSQHPADL-WROBTOGHSA-N |
| XLogP | -0.55 |
| TPSA | 214.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|