C11H14N8O4P+ — CID 175453397
[5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium (PubChem CID 175453397) has the molecular formula C11H14N8O4P+ and a molecular weight of 353.26 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium.
| Compound Name | [5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium |
|---|---|
| PubChem CID | 175453397 |
| Molecular Formula | C11H14N8O4P+ |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3-azido-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium |
| SMILES | [N-]=[N+]=NC1C(COC[PH+]=O)OC(n2cnc3c(N)ncnc32)C1O |
| InChI | InChI=1S/C11H13N8O4P/c12-9-7-10(15-2-14-9)19(3-16-7)11-8(20)6(17-18-13)5(23-11)1-22-4-24-21/h2-3,5-6,8,11,20H,1,4H2,(H2,12,14,15)/p+1 |
| InChIKey | UFLAZWYDRHJXSI-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 174.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|