C11H14FN5O4P+ — CID 175453379
[5-(6-aminopurin-9-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium (PubChem CID 175453379) has the molecular formula C11H14FN5O4P+ and a molecular weight of 330.24 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium.
| Compound Name | [5-(6-aminopurin-9-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium |
|---|---|
| PubChem CID | 175453379 |
| Molecular Formula | C11H14FN5O4P+ |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3-fluoro-4-hydroxyoxolan-2-yl]methoxymethyl-oxophosphanium |
| SMILES | Nc1ncnc2c1ncn2C1OC(COC[PH+]=O)C(F)C1O |
| InChI | InChI=1S/C11H13FN5O4P/c12-6-5(1-20-4-22-19)21-11(8(6)18)17-3-16-7-9(13)14-2-15-10(7)17/h2-3,5-6,8,11,18H,1,4H2,(H2,13,14,15)/p+1 |
| InChIKey | DTXRGQGFQOIDEP-UHFFFAOYSA-O |
| XLogP | 0.00 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|