C10H13FN5O5PS — CID 166086619
(2R,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-fluorooxolan-3-ol (PubChem CID 166086619) has the molecular formula C10H13FN5O5PS and a molecular weight of 365.28 g/mol. Its IUPAC name is (2R,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-fluorooxolan-3-ol.
| Compound Name | (2R,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 166086619 |
| Molecular Formula | C10H13FN5O5PS |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | (2R,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-fluorooxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(O)(O)=S)C(O)C1F |
| InChI | InChI=1S/C10H13FN5O5PS/c11-5-7(17)4(1-20-22(18,19)23)21-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17H,1H2,(H2,12,13,14)(H2,18,19,23)/t4-,5?,7?,10-/m1/s1 |
| InChIKey | DGNMCWIFENLHNP-LKYYUADZSA-N |
| XLogP | -0.77 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|