C10H13N8O5PS — CID 176612749
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol (PubChem CID 176612749) has the molecular formula C10H13N8O5PS and a molecular weight of 388.31 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 176612749 |
| Molecular Formula | C10H13N8O5PS |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](O)[C@@H](COP(O)(O)=S)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C10H13N8O5PS/c11-8-6-9(14-2-13-8)18(3-15-6)10-5(16-17-12)7(19)4(23-10)1-22-24(20,21)25/h2-5,7,10,19H,1H2,(H2,11,13,14)(H2,20,21,25)/t4-,5-,7-,10-/m1/s1 |
| InChIKey | UNBOYMNQAOFLFI-QYYRPYCUSA-N |
| XLogP | -0.43 |
| TPSA | 197.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|