C10H21N8O15P3 — CID 21125637
(2R,3S,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol;phosphoric acid (PubChem CID 21125637) has the molecular formula C10H21N8O15P3 and a molecular weight of 586.24 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol;phosphoric acid.
| Compound Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol;phosphoric acid |
|---|---|
| PubChem CID | 21125637 |
| Molecular Formula | C10H21N8O15P3 |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol;phosphoric acid |
| SMILES | O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O.[N-]=[N+]=NC1[C@H](n2cnc3c(N)ncnc32)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C10H12N8O3.3H3O4P/c11-8-6-9(14-2-13-8)18(3-15-6)10-5(16-17-12)7(20)4(1-19)21-10;3*1-5(2,3)4/h2-5,7,10,19-20H,1H2,(H2,11,13,14);3*(H3,1,2,3,4)/t4-,5?,7-,10-;;;/m1.../s1 |
| InChIKey | SHZNBVLDMGZXQM-GXYCKGFDSA-N |
| XLogP | -3.45 |
| TPSA | 401.35 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|