C10H18N5O9P — CID 23615236
(2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;hydrate (PubChem CID 23615236) has the molecular formula C10H18N5O9P and a molecular weight of 383.25 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;hydrate.
| Compound Name | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;hydrate |
|---|---|
| PubChem CID | 23615236 |
| Molecular Formula | C10H18N5O9P |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid;hydrate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O.O.O=P(O)(O)O |
| InChI | InChI=1S/C10H13N5O4.H3O4P.H2O/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-5(2,3)4;/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);(H3,1,2,3,4);1H2/t4-,6-,7+,10-;;/m1../s1 |
| InChIKey | RXFAYFRTWFMDTO-MMGZGRSYSA-N |
| XLogP | -3.73 |
| TPSA | 248.80 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|