C10H17N6O7P — CID 67178722
aminophosphonic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 67178722) has the molecular formula C10H17N6O7P and a molecular weight of 364.26 g/mol. Its IUPAC name is aminophosphonic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | aminophosphonic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 67178722 |
| Molecular Formula | C10H17N6O7P |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | aminophosphonic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NP(=O)(O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N5O4.H4NO3P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-5(2,3)4/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);(H4,1,2,3,4)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | IQCCQUBKYCVKGG-MCDZGGTQSA-N |
| XLogP | -2.94 |
| TPSA | 223.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|