C12H16N5O5PS — CID 174013661
(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-ethenyloxolan-3-ol (PubChem CID 174013661) has the molecular formula C12H16N5O5PS and a molecular weight of 373.33 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-ethenyloxolan-3-ol.
| Compound Name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-ethenyloxolan-3-ol |
|---|---|
| PubChem CID | 174013661 |
| Molecular Formula | C12H16N5O5PS |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-(dihydroxyphosphinothioyloxymethyl)-4-ethenyloxolan-3-ol |
| SMILES | C=C[C@H]1[C@H](O)[C@@H](COP(O)(O)=S)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H16N5O5PS/c1-2-6-9(18)7(3-21-23(19,20)24)22-12(6)17-5-16-8-10(13)14-4-15-11(8)17/h2,4-7,9,12,18H,1,3H2,(H2,13,14,15)(H2,19,20,24)/t6-,7+,9-,12+/m0/s1 |
| InChIKey | FCGDJUWPYFPSKC-VDTLEJJOSA-N |
| XLogP | -0.31 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|