C10H14N5O5PS — CID 155062621
(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol (PubChem CID 155062621) has the molecular formula C10H14N5O5PS and a molecular weight of 347.29 g/mol. Its IUPAC name is (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 155062621 |
| Molecular Formula | C10H14N5O5PS |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(dihydroxyphosphinothioyloxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(O)(O)=S)C[C@H]1O |
| InChI | InChI=1S/C10H14N5O5PS/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(16)1-5(20-10)2-19-21(17,18)22/h3-6,10,16H,1-2H2,(H2,11,12,13)(H2,17,18,22)/t5-,6+,10+/m0/s1 |
| InChIKey | SVYWCWWJKXHJPP-BAJZRUMYSA-N |
| XLogP | -0.72 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|