C10H15MgN5O3 — CID 174820086
magnesium;(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;hydride (PubChem CID 174820086) has the molecular formula C10H15MgN5O3 and a molecular weight of 277.57 g/mol. Its IUPAC name is magnesium;(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;hydride.
| Compound Name | magnesium;(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;hydride |
|---|---|
| PubChem CID | 174820086 |
| Molecular Formula | C10H15MgN5O3 |
| Molecular Weight | 277.57 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | magnesium;(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;hydride |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C[C@H]1O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C10H13N5O3.Mg.2H/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10;;;/h3-6,10,16-17H,1-2H2,(H2,11,12,13);;;/q;+2;2*-1/t5-,6+,10+;;;/m0.../s1 |
| InChIKey | BIMDCCXMGLNYIK-NPVJFQHYSA-N |
| XLogP | -1.11 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.57 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |