C11H15N5O2S — CID 91227656
(2R,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolan-3-ol (PubChem CID 91227656) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is (2R,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolan-3-ol.
| Compound Name | (2R,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 91227656 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (2R,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolan-3-ol |
| SMILES | CSC[C@@H]1CC(O)[C@H](n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C11H15N5O2S/c1-19-3-6-2-7(17)11(18-6)16-5-15-8-9(12)13-4-14-10(8)16/h4-7,11,17H,2-3H2,1H3,(H2,12,13,14)/t6-,7?,11+/m0/s1 |
| InChIKey | KLTQZXHABWFANM-NSMOOJLNSA-N |
| XLogP | 0.42 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |