C19H24N10O8P+ — CID 171428862
bis[[5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium (PubChem CID 171428862) has the molecular formula C19H24N10O8P+ and a molecular weight of 551.44 g/mol. Its IUPAC name is bis[[5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium.
| Compound Name | bis[[5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium |
|---|---|
| PubChem CID | 171428862 |
| Molecular Formula | C19H24N10O8P+ |
| Molecular Weight | 551.44 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | bis[[5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium |
| SMILES | CO[P+](O)(OC1CC(O)C(n2cnc3c(N)ncnc32)O1)OC1CC(O)C(n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C19H24N10O8P/c1-33-38(32,36-10-2-8(30)18(34-10)28-6-26-12-14(20)22-4-24-16(12)28)37-11-3-9(31)19(35-11)29-7-27-13-15(21)23-5-25-17(13)29/h4-11,18-19,30-32H,2-3H2,1H3,(H2,20,22,24)(H2,21,23,25)/q+1 |
| InChIKey | OWVDQVAHRYCNNP-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 246.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.44 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|