C25H38N12O8P+ — CID 176620392
bis[[5-[6-amino-8-(propan-2-ylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium (PubChem CID 176620392) has the molecular formula C25H38N12O8P+ and a molecular weight of 665.63 g/mol. Its IUPAC name is bis[[5-[6-amino-8-(propan-2-ylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium.
| Compound Name | bis[[5-[6-amino-8-(propan-2-ylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium |
|---|---|
| PubChem CID | 176620392 |
| Molecular Formula | C25H38N12O8P+ |
| Molecular Weight | 665.63 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | bis[[5-[6-amino-8-(propan-2-ylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]oxy]-hydroxy-methoxyphosphanium |
| SMILES | CO[P+](O)(OC1CC(O)C(n2c(NC(C)C)nc3c(N)ncnc32)O1)OC1CC(O)C(n2c(NC(C)C)nc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C25H38N12O8P/c1-10(2)32-24-34-16-18(26)28-8-30-20(16)36(24)22-12(38)6-14(42-22)44-46(40,41-5)45-15-7-13(39)23(43-15)37-21-17(19(27)29-9-31-21)35-25(37)33-11(3)4/h8-15,22-23,38-40H,6-7H2,1-5H3,(H,32,34)(H,33,35)(H2,26,28,30)(H2,27,29,31)/q+1 |
| InChIKey | ZIFMUWZVHVGWGQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 270.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.63 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|