C11H15N5O3 — CID 90728426
(2R,3S,5R)-5-(6-amino-8-methoxypurin-9-yl)-2-methyloxolan-3-ol (PubChem CID 90728426) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-amino-8-methoxypurin-9-yl)-2-methyloxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(6-amino-8-methoxypurin-9-yl)-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 90728426 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (2R,3S,5R)-5-(6-amino-8-methoxypurin-9-yl)-2-methyloxolan-3-ol |
| SMILES | COc1nc2c(N)ncnc2n1[C@H]1C[C@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C11H15N5O3/c1-5-6(17)3-7(19-5)16-10-8(15-11(16)18-2)9(12)13-4-14-10/h4-7,17H,3H2,1-2H3,(H2,12,13,14)/t5-,6+,7-/m1/s1 |
| InChIKey | ZYEUAPUPTRUSAY-DSYKOEDSSA-N |
| XLogP | 0.09 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |