C10H12BrN5NaO6P — CID 24824598
sodium [(2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 24824598) has the molecular formula C10H12BrN5NaO6P and a molecular weight of 432.10 g/mol. Its IUPAC name is sodium [(2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | sodium [(2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 24824598 |
| Molecular Formula | C10H12BrN5NaO6P |
| Molecular Weight | 432.10 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | sodium [(2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1ncnc2c1nc(Br)n2[C@H]1C[C@H](O)[C@@H](COP(=O)([O-])O)O1.[Na+] |
| InChI | InChI=1S/C10H13BrN5O6P.Na/c11-10-15-7-8(12)13-3-14-9(7)16(10)6-1-4(17)5(22-6)2-21-23(18,19)20;/h3-6,17H,1-2H2,(H2,12,13,14)(H2,18,19,20);/q;+1/p-1/t4-,5+,6+;/m0./s1 |
| InChIKey | BKEAPLPYGPLNHG-FPKZOZHISA-M |
| XLogP | -3.70 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.10 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|