C10H13N5NaO7P — CID 155888686
sodium [5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 155888686) has the molecular formula C10H13N5NaO7P and a molecular weight of 369.21 g/mol. Its IUPAC name is sodium [5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | sodium [5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 155888686 |
| Molecular Formula | C10H13N5NaO7P |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | sodium [5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2C2CC(O)C(COP(=O)([O-])O)O2)c(=O)[nH]1.[Na+] |
| InChI | InChI=1S/C10H14N5O7P.Na/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20;/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17);/q;+1/p-1 |
| InChIKey | WHAXGYYQGCWDBG-UHFFFAOYSA-M |
| XLogP | -5.17 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|