C10H15N5NaO8P — CID 135705227
sodium;[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;hydrate (PubChem CID 135705227) has the molecular formula C10H15N5NaO8P and a molecular weight of 387.22 g/mol. Its IUPAC name is sodium;[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;hydrate.
| Compound Name | sodium;[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;hydrate |
|---|---|
| PubChem CID | 135705227 |
| Molecular Formula | C10H15N5NaO8P |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | sodium;[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate;hydrate |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](COP(=O)([O-])O)O2)c(=O)[nH]1.O.[Na+] |
| InChI | InChI=1S/C10H14N5O7P.Na.H2O/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20;;/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17);;1H2/q;+1;/p-1/t4-,5+,6+;;/m0../s1 |
| InChIKey | UVKXYXSKMTUDML-FVALZTRZSA-M |
| XLogP | -5.99 |
| TPSA | 220.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | -5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|