C10H15N5O10P2 — CID 171382155
[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methyl phosphono hydrogen phosphate (PubChem CID 171382155) has the molecular formula C10H15N5O10P2 and a molecular weight of 432.16 g/mol. Its IUPAC name is [(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methyl phosphono hydrogen phosphate.
| Compound Name | [(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 171382155 |
| Molecular Formula | C10H15N5O10P2 |
| Molecular Weight | 432.16 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | [(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy(2,3,4,5-13C4)oxolan-2-yl](113C)methyl phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[13C@H]2[13CH2][13CH](O)[13CH]([13CH2]OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N5O10P2/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(24-6)2-23-27(21,22)25-26(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H2,18,19,20)(H3,11,13,14,17)/t4?,5?,6-/m1/s1/i1+1,2+1,4+1,5+1,6+1 |
| InChIKey | CIKGWCTVFSRMJU-CANMFTPZSA-N |
| XLogP | -1.42 |
| TPSA | 232.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.16 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|