C10H12N5O9P2S-3 — CID 137279664
[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dioxidophosphinothioyl phosphate (PubChem CID 137279664) has the molecular formula C10H12N5O9P2S-3 and a molecular weight of 440.25 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dioxidophosphinothioyl phosphate.
| Compound Name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dioxidophosphinothioyl phosphate |
|---|---|
| PubChem CID | 137279664 |
| Molecular Formula | C10H12N5O9P2S-3 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dioxidophosphinothioyl phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP([O-])([O-])=S)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N5O9P2S/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(23-6)2-22-25(18,19)24-26(20,21)27/h3-6,16H,1-2H2,(H,18,19)(H2,20,21,27)(H3,11,13,14,17)/p-3/t4-,5+,6+/m0/s1 |
| InChIKey | AHBLBNOTOPAPER-KVQBGUIXSA-K |
| XLogP | -3.20 |
| TPSA | 223.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|