C10H16N5O11P3S2 — CID 135430423
[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-sulfanylphosphinothioyl] phosphono hydrogen phosphate (PubChem CID 135430423) has the molecular formula C10H16N5O11P3S2 and a molecular weight of 539.32 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-sulfanylphosphinothioyl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-sulfanylphosphinothioyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135430423 |
| Molecular Formula | C10H16N5O11P3S2 |
| Molecular Weight | 539.32 g/mol |
| Exact Mass | 538.95 |
| IUPAC Name | [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-sulfanylphosphinothioyl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](COP(=S)(S)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N5O11P3S2/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(24-6)2-23-29(30,31)26-28(21,22)25-27(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,30,31)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
| InChIKey | JDALYXGJTWNUHD-KVQBGUIXSA-N |
| XLogP | -0.25 |
| TPSA | 241.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|