C10H17N6O13P3 — CID 170904674
[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 170904674) has the molecular formula C10H17N6O13P3 and a molecular weight of 522.20 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170904674 |
| Molecular Formula | C10H17N6O13P3 |
| Molecular Weight | 522.20 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NOC1CC(n2cnc3c(=O)[nH]c(N)nc32)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H17N6O13P3/c11-10-14-8-7(9(17)15-10)13-3-16(8)6-1-4(27-12)5(26-6)2-25-31(21,22)29-32(23,24)28-30(18,19)20/h3-6H,1-2,12H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,14,15,17) |
| InChIKey | JDFUCZPRZYSQGR-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 293.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.20 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|