C12H19N8O13P3 — CID 167672194
[[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(1R)-1-azidoethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 167672194) has the molecular formula C12H19N8O13P3 and a molecular weight of 576.25 g/mol. Its IUPAC name is [[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(1R)-1-azidoethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(1R)-1-azidoethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 167672194 |
| Molecular Formula | C12H19N8O13P3 |
| Molecular Weight | 576.25 g/mol |
| Exact Mass | 576.03 |
| IUPAC Name | [[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(1R)-1-azidoethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@H](N=[N+]=[N-])OC1C[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H19N8O13P3/c1-5(18-19-14)30-6-2-8(20-4-15-9-10(20)16-12(13)17-11(9)21)31-7(6)3-29-35(25,26)33-36(27,28)32-34(22,23)24/h4-8H,2-3H2,1H3,(H,25,26)(H,27,28)(H2,22,23,24)(H3,13,16,17,21)/t5-,6?,7-,8-/m1/s1 |
| InChIKey | GJIRQPMYOYOTPJ-NIVRMLGLSA-N |
| XLogP | 0.37 |
| TPSA | 316.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|