C13H22N5O13P3S2 — CID 174031329
[[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174031329) has the molecular formula C13H22N5O13P3S2 and a molecular weight of 613.40 g/mol. Its IUPAC name is [[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174031329 |
| Molecular Formula | C13H22N5O13P3S2 |
| Molecular Weight | 613.40 g/mol |
| Exact Mass | 612.99 |
| IUPAC Name | [[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCSSCO[C@@H]1C[C@H](n2cnc3c(=O)[nH]c(N)nc32)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H22N5O13P3S2/c1-2-35-36-6-27-7-3-9(18-5-15-10-11(18)16-13(14)17-12(10)19)29-8(7)4-28-33(23,24)31-34(25,26)30-32(20,21)22/h5,7-9H,2-4,6H2,1H3,(H,23,24)(H,25,26)(H2,20,21,22)(H3,14,16,17,19)/t7-,8?,9-/m1/s1 |
| InChIKey | PPYXGPAGXGWIOT-PSGOWDBMSA-N |
| XLogP | 1.08 |
| TPSA | 267.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|