C15H24N5O9P2S2+ — CID 176838032
[[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium (PubChem CID 176838032) has the molecular formula C15H24N5O9P2S2+ and a molecular weight of 544.47 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium.
| Compound Name | [[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 176838032 |
| Molecular Formula | C15H24N5O9P2S2+ |
| Molecular Weight | 544.47 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | [[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[(tert-butyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium |
| SMILES | CC(C)(C)SSCO[C@@H]1C[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1COP(=O)(O)O[P+](=O)O |
| InChI | InChI=1S/C15H23N5O9P2S2/c1-15(2,3)33-32-7-26-8-4-10(28-9(8)5-27-31(24,25)29-30(22)23)20-6-17-11-12(20)18-14(16)19-13(11)21/h6,8-10H,4-5,7H2,1-3H3,(H4-,16,18,19,21,22,23,24,25)/p+1/t8-,9-,10-/m1/s1 |
| InChIKey | MVZROPHORZHYRM-OPRDCNLKSA-O |
| XLogP | 2.30 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|