C13H22N5O12P3S2 — CID 163997238
[[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 163997238) has the molecular formula C13H22N5O12P3S2 and a molecular weight of 597.40 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 163997238 |
| Molecular Formula | C13H22N5O12P3S2 |
| Molecular Weight | 597.40 g/mol |
| Exact Mass | 596.99 |
| IUPAC Name | [[(2R,3R,5R)-5-(6-aminopurin-9-yl)-3-[(ethyldisulfanyl)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCSSCO[C@@H]1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H22N5O12P3S2/c1-2-34-35-7-26-8-3-10(18-6-17-11-12(14)15-5-16-13(11)18)28-9(8)4-27-32(22,23)30-33(24,25)29-31(19,20)21/h5-6,8-10H,2-4,7H2,1H3,(H,22,23)(H,24,25)(H2,14,15,16)(H2,19,20,21)/t8-,9-,10-/m1/s1 |
| InChIKey | UFUINRZGNBASLV-OPRDCNLKSA-N |
| XLogP | 1.78 |
| TPSA | 247.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|