C12H18FN8O12P3 — CID 167702141
[[(2R,5R)-5-(6-aminopurin-9-yl)-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 167702141) has the molecular formula C12H18FN8O12P3 and a molecular weight of 578.24 g/mol. Its IUPAC name is [[(2R,5R)-5-(6-aminopurin-9-yl)-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-(6-aminopurin-9-yl)-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 167702141 |
| Molecular Formula | C12H18FN8O12P3 |
| Molecular Weight | 578.24 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | [[(2R,5R)-5-(6-aminopurin-9-yl)-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@](F)(N=[N+]=[N-])OC1C[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H18FN8O12P3/c1-12(13,19-20-15)31-6-2-8(21-5-18-9-10(14)16-4-17-11(9)21)30-7(6)3-29-35(25,26)33-36(27,28)32-34(22,23)24/h4-8H,2-3H2,1H3,(H,25,26)(H,27,28)(H2,14,16,17)(H2,22,23,24)/t6?,7-,8-,12-/m1/s1 |
| InChIKey | GPJAZJMQAHPMEY-FXGWEAOSSA-N |
| XLogP | 1.38 |
| TPSA | 296.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|