C14H21FN7O12P3 — CID 167543684
[[(2R,5R)-5-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 167543684) has the molecular formula C14H21FN7O12P3 and a molecular weight of 591.28 g/mol. Its IUPAC name is [[(2R,5R)-5-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 167543684 |
| Molecular Formula | C14H21FN7O12P3 |
| Molecular Weight | 591.28 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | [[(2R,5R)-5-[(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-[(1R)-1-azido-1-fluoroethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@](F)(N=[N+]=[N-])OC1C[C@H](Cn2ccc3c(N)ncnc32)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C14H21FN7O12P3/c1-14(15,20-21-17)32-10-4-8(5-22-3-2-9-12(16)18-7-19-13(9)22)31-11(10)6-30-36(26,27)34-37(28,29)33-35(23,24)25/h2-3,7-8,10-11H,4-6H2,1H3,(H,26,27)(H,28,29)(H2,16,18,19)(H2,23,24,25)/t8-,10?,11-,14-/m1/s1 |
| InChIKey | CCGPQGHHVPGTPQ-LJCHNNMDSA-N |
| XLogP | 1.85 |
| TPSA | 283.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|